ChemNet > CAS > 1210-34-0 Dibenzosuberol
1210-34-0 Dibenzosuberol
product Name |
Dibenzosuberol |
Synonyms |
10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ol; dibenzo(b,f)cycloheptan-1-ol; Dibenzo[b,f]-1-cycloheptanol; 10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ol; 10,11-Dihydro-5H-dibenzo[a,d]cyclohetpten-5-ol |
Molecular Formula |
C15H14O |
Molecular Weight |
210.2711 |
InChI |
InChI=1/C15H14O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2 |
CAS Registry Number |
1210-34-0 |
EINECS |
214-911-8 |
Molecular Structure |
|
Density |
1.163g/cm3 |
Melting point |
90-95℃ |
Boiling point |
365.5°C at 760 mmHg |
Refractive index |
1.633 |
Flash point |
135.6°C |
Vapour Pressur |
5.51E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|